♚ \

Author: Jclian, I have been engaged in Python for more than a year. I am a Python lover, like algorithm, and love to share. I hope to make more friends with like-minded people to learn Python and go further together!

Keras introduction

Keras is an open source high-level neural network API written in pure Python, with a backend that can be based on Tensorflow, Theano, MXNet, and CNTK. Keras is designed to support rapid experimentation and quickly turn your ideas into results. The Python version for Keras is: Python 2.7-3.6. Keras, which means “horn” in Greek, was first released in March 2015 and runs on Windows, Linux, Mac and more. So why do you need Keras when you have TensorFlow (or Theano, MXNet, CNTK)? This is because although we can use TensorFlow and others to create deep neural network system, but TensorFlow and others use relatively low-level abstraction, it is challenging to write the code of TensorFlow directly. Keras, on the basis of TensorFlow, adds an abstraction layer that is easy to use. It is easier and more efficient to use. What kind of occasion is appropriate to use Keras? Please select Keras if you have the following requirements:

  • Easy and fast prototyping (Keras is highly modular, minimalist, and extensible)
  • Support CNN and RNN, or a combination of both
  • Seamless CPU and GPU switching

To use Keras on your computer, you need the following tools:

  • Python
  • TensorFlow
  • Keras

Here, we chose TensorFlow as the back-end tool for Keras. The following Python code outputs the version numbers of Python, TensorFlow, and Keras:

import sys
import keras as K
import tensorflow as tf

py_ver = sys.version
k_ver = K.__version__
tf_ver = tf.__version__

print("Using Python version " + str(py_ver))
print("Using Keras version " + str(k_ver))
print("Using TensorFlow version " + str(tf_ver))
Copy the code

On my computer, the output is as follows:

Using TensorFlow backend. Using Python version 3.5.1 (V3.5.1:37a07CEe5969, Dec 6 2015, 01:54:25) [MSC V. 1900 64-bit (AMD64)] Using Keras version 2.1.5 Using TensorFlow version 1.6.0Copy the code

Next, the author will use IRIS data set (IRIS data set, a classic machine learning data set, suitable for multi-classification problem test data) and use Keras to build a deep neural network (DNN) to solve the multi-classification problem of IRIS data set, as the first example of Keras introduction.

Introduction to IRIS data sets

IRIS data set (the IRIS data set), is a classic machine learning data sets, and is suitable for the test data as the multiple classification problems, its download address is: archive.ics.uci.edu/ml/machine-… IRIS data set is a data set used to classify irises. There are 150 samples in total. Each sample contained four characteristics: sepal length in cm, sepal width in cm, petal length in cm, petal width in cm, which divided iris into three categories. Iris Setosa, Iris Versicolour, Iris Virginica, 50 samples in each category. The IRIS data set is as follows (only part of the data is shown, in disordered order) : \

Iris dataset preview

Read data set

The IRIS dataset is stored in CSV format. Pandas is used to read the IRIS dataset and one-hot Encoding of the target variables. The dataset is divided into training set and test set in a 7:3 ratio. The complete Python code is as follows:

import pandas as pd
from sklearn.model_selection import train_test_split
from sklearn.preprocessing import LabelBinarizer

Read the CSV data set and split it into training set and test set
CSV_FILE_PATH: CSV file path
def load_data(CSV_FILE_PATH) :
    IRIS = pd.read_csv(CSV_FILE_PATH)
    target_var = 'class'  # Target variable
    # Data set characteristics
    features = list(IRIS.columns)
    features.remove(target_var)
    # Category of target variable
    Class = IRIS[target_var].unique()
    Class dictionary of target variables
    Class_dict = dict(zip(Class, range(len(Class))))
    Add a column of targets to encode the target variable
    IRIS['target'] = IRIS[target_var].apply(lambda x: Class_dict[x])
    # Single-hot Encoding 0-1 for target variable
    lb = LabelBinarizer()
    lb.fit(list(Class_dict.values()))
    transformed_labels = lb.transform(IRIS['target'])
    y_bin_labels = []  # Variables encoded 0-1 for multiple categories
    for i in range(transformed_labels.shape[1]):
        y_bin_labels.append('y' + str(i))
        IRIS['y' + str(i)] = transformed_labels[:, i]
    # Divide the data set into training set and test set
    train_x, test_x, train_y, test_y = train_test_split(IRIS[features], IRIS[y_bin_labels], 
                                                        train_size=0.7, test_size=0.3, random_state=0)
    return train_x, test_x, train_y, test_y, Class_dict
Copy the code

Set up within DNN

Next, I will show how Keras can be used to build a simple deep neural network (DNN) to solve this multi-classification problem. The structure of DNN we want to build is as follows:

DNN structure diagram

The DNN we built is composed of input layer, hidden layer, output layer and Softmax function. The input layer is composed of 4 neurons corresponding to 4 features in IRIS data set. As the input vector, the hidden layer has two layers, each layer has 5 and 6 neurons respectively. The number of categories of the target variable corresponding to the IRIS data set, and finally, a Softmax function created to solve the multi-category problem. The Python code for the DNN structure is as follows:

   import keras as K
    # 2. Define the model
    init = K.initializers.glorot_uniform(seed=1)
    simple_adam = K.optimizers.Adam()
    model = K.models.Sequential()
    model.add(K.layers.Dense(units=5, input_dim=4, kernel_initializer=init, activation='relu'))
    model.add(K.layers.Dense(units=6, kernel_initializer=init, activation='relu'))
    model.add(K.layers.Dense(units=3, kernel_initializer=init, activation='softmax'))
    model.compile(loss='categorical_crossentropy', optimizer=simple_adam, metrics=['accuracy'])
Copy the code

In this model, we chose the neuron activation function as ReLU function, the loss function as cross entropy, the iterative optimizer chose Adam, and initially the weights and biases of each layer were randomly generated. So we’re done with the definition of this DNN model. That simple? Yes, that’s it!

Training and Forecasting

OK, after defining the model, we need to train, evaluate, and predict the model. For model training, the number of batches for each training is 1, with a total of 100 iterations. The code is as follows (following the above code) :

    # 3. Training model
    b_size = 1
    max_epochs = 100
    print("Starting training ")
    h = model.fit(train_x, train_y, batch_size=b_size, epochs=max_epochs, shuffle=True, verbose=1)
    print("Training finished ")
Copy the code

In order to evaluate the model and perceive the performance of the model, it is necessary to output the value of the loss function of the DNN model and its accuracy on the test set. Its Python code is as follows (following the above code) :

    # 4. Evaluation model
    eval = model.evaluate(test_x, test_y, verbose=0)
    print("Evaluation on test data: Loss = %0.6f Accuracy = %0.2f%%" 
          % (eval[0].eval[1] * 100))Copy the code

Training 100 times, the output is as follows (the middle part of the training demonstration has been ignored) :

Starting training Epoch 1/100 1/105 [..............................] - ETA: 17 s - loss: 0.3679 - acc: 1.0000 42/105 [= = = = = = = = = = = >...] - ETA: 0 s - loss: 1.8081 - acc: 0.3095 89/105 [= = = = = = = = = = = = = = = = = = = = = = = = >... - ETA: 0 s - loss: 1.5068 acc: 0.4270 105/105 [= = = = = = = = = = = = = = = = = = = = = = = = = = = = = =] - 0 s 3 ms/step - loss: 1.4164 acc: 0.4667 Epoch 2/100 1/105 [...] - ETA: 0 s - loss: 0.4766 - acc: 1.0000 45/105 [= = = = = = = = = = = >...] - ETA: 0 s - loss: 1.0813 - acc: 0.4889 93/105 [= = = = = = = = = = = = = = = = = = = = = = = = = >... - ETA: 0 s - loss: 1.0335 acc: 0.4839 105/105 [= = = = = = = = = = = = = = = = = = = = = = = = = = = = = =] 0 1 ms/s step - loss: 1.0144 acc: 0.4857... Epoch 99/100 1/105 [..............................] - ETA: 0 s - loss: 0.0013 - acc: 1.0000 43/105 [= = = = = = = = = = = >...] - ETA: 0 s - loss: 0.0447 - acc: 0.9767 84/105 [= = = = = = = = = = = = = = = = = = = = = = = >...] - ETA: 0 s - loss: 0.0824 acc: 0.9524 105/105 [= = = = = = = = = = = = = = = = = = = = = = = = = = = = = =] 0 1 ms/s step - loss: 0.0711 acc: 0.9619 Epoch 100/100 1/105 [...] - ETA: 0 s - loss: 2.3032 - acc: 0.0000 e+00 51/105 [= = = = = = = = = = = = = >...] - ETA: 0 s - loss: 0.1122 - acc: 0.9608 99/105 [= = = = = = = = = = = = = = = = = = = = = = = = = = = >..] - ETA: 0 s - loss: 0.0755 acc: 0.9798 105/105 [= = = = = = = = = = = = = = = = = = = = = = = = = = = = = =] 0 1 ms/s step - loss: 0.0756 acc: 0.9810 Training finished Evaluation on test data: Loss = 0.094882 accuracy = 97.78%Copy the code

It can be seen that after 100 times of training, the accuracy rate on the test set has reached 97.78%, which is quite good. Finally, the prediction of the new data set is made. We assume that the four features of an iris are 6.1,3.1,5.1 and 1.1. We want to know which category this DNN model will predict, and its Python code is as follows:

   import numpy as np
    # 5. Use models for prediction
    np.set_printoptions(precision=4)
    unknown = np.array([[6.1.3.1.5.1.1.1]], dtype=np.float32)
    predicted = model.predict(unknown)
    print("Using model to predict species for features: ")
    print(unknown)
    print("
Predicted softmax vector is: ")
    print(predicted)
    species_dict = {v:k for k,v in Class_dict.items()}
    print("
Predicted species is: ")
    print(species_dict[np.argmax(predicted)])
Copy the code

The output is as follows:

Using model to predict species for features: [[6.1 3.1 5.1 1.1]] Predicted Softmax vector is: [[2.0687E-07 9.7901E-01 2.0993e-02]] Predicted Species is versicolorCopy the code

If we compare IRIS data set carefully, we will find that this prediction result is quite satisfactory, and the prediction result of this IRIS sample should also be Versicolor from the human perspective.

conclusion

So far, I’ve covered this demo, which is still a good first step to getting started with Keras. To review the model, we used Pandas to read the IRIS dataset, divided it into training sets and test sets, constructed a simple DNN model using Keras, trained and evaluated the model, and then examined the predictive power of the model on the new dataset. The reader will appreciate the advantages of Keras, because it will take longer Python code than Keras to build the same DNN model and train, evaluate, and predict the model than TensorFlow. Finally, attach the full Python code for the DNN model:

# iris_keras_dnn.py
# Python 3.5.1, TensorFlow 1.6.0, Keras 2.1.5
# = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = = =
# import module
import os
import numpy as np
import keras as K
import tensorflow as tf
import pandas as pd
from sklearn.model_selection import train_test_split
from sklearn.preprocessing import LabelBinarizer
os.environ['TF_CPP_MIN_LOG_LEVEL'] ='2'

Read the CSV data set and split it into training set and test set
CSV_FILE_PATH: CSV file path
def load_data(CSV_FILE_PATH) :
    IRIS = pd.read_csv(CSV_FILE_PATH)
    target_var = 'class'  # Target variable
    # Data set characteristics
    features = list(IRIS.columns)
    features.remove(target_var)
    # Category of target variable
    Class = IRIS[target_var].unique()
    Class dictionary of target variables
    Class_dict = dict(zip(Class, range(len(Class))))
    Add a column of targets to encode the target variable
    IRIS['target'] = IRIS[target_var].apply(lambda x: Class_dict[x])
    # Single-hot Encoding 0-1 for target variable
    lb = LabelBinarizer()
    lb.fit(list(Class_dict.values()))
    transformed_labels = lb.transform(IRIS['target'])
    y_bin_labels = []  # Variables encoded 0-1 for multiple categories
    for i in range(transformed_labels.shape[1]):
        y_bin_labels.append('y' + str(i))
        IRIS['y' + str(i)] = transformed_labels[:, i]
    # Divide the data set into training set and test set
    train_x, test_x, train_y, test_y = train_test_split(IRIS[features], IRIS[y_bin_labels], 
                                                        train_size=0.7, test_size=0.3, random_state=0)
    return train_x, test_x, train_y, test_y, Class_dict

def main() :

    # 0. Start
    print("
Iris dataset using Keras/TensorFlow ")
    np.random.seed(4)
    tf.set_random_seed(13)

    # 1. Read the CSV data set
    print("Loading Iris data into memory")
    CSV_FILE_PATH = 'E://iris.csv'
    train_x, test_x, train_y, test_y, Class_dict = load_data(CSV_FILE_PATH)

    # 2. Define the model
    init = K.initializers.glorot_uniform(seed=1)
    simple_adam = K.optimizers.Adam()
    model = K.models.Sequential()
    model.add(K.layers.Dense(units=5, input_dim=4, kernel_initializer=init, activation='relu'))
    model.add(K.layers.Dense(units=6, kernel_initializer=init, activation='relu'))
    model.add(K.layers.Dense(units=3, kernel_initializer=init, activation='softmax'))
    model.compile(loss='categorical_crossentropy', optimizer=simple_adam, metrics=['accuracy'])

    # 3. Training model
    b_size = 1
    max_epochs = 100
    print("Starting training ")
    h = model.fit(train_x, train_y, batch_size=b_size, epochs=max_epochs, shuffle=True, verbose=1)
    print("Training finished ")

    # 4. Evaluation model
    eval = model.evaluate(test_x, test_y, verbose=0)
    print("Evaluation on test data: Loss = %0.6f Accuracy = %0.2f%%" 
          % (eval[0].eval[1] * 100))# 5. Use models for prediction
    np.set_printoptions(precision=4)
    unknown = np.array([[6.1.3.1.5.1.1.1]], dtype=np.float32)
    predicted = model.predict(unknown)
    print("Using model to predict species for features: ")
    print(unknown)
    print("
Predicted softmax vector is: ")
    print(predicted)
    species_dict = {v:k for k,v in Class_dict.items()}
    print("
Predicted species is: ")
    print(species_dict[np.argmax(predicted)])

main()
Copy the code

reference

  1. Keras Chinese document: Keras – cn. Readthedocs. IO/en/latest /
  2. Keras Succinctly: ebooks.syncfusion.com/downloads/k…
  3. IRIS data set: archive.ics.uci.edu/ml/machine-…

§ § \

Python Chinese community as a decentralized global technology community, to become the world’s 200000 Python tribe as the vision, the spirit of Chinese developers currently covered each big mainstream media and collaboration platform, and ali, tencent, baidu, Microsoft, amazon and open China, CSDN industry well-known companies and established wide-ranging connection of the technical community, Have come from more than 10 countries and regions tens of thousands of registered members, members from the Ministry of Public Security, ministry of industry, tsinghua university, Beijing university, Beijing university of posts and telecommunications, the People’s Bank of China, the Chinese Academy of Sciences, cicc, huawei, BAT, represented by Google, Microsoft and other government departments, scientific research institutions, financial institutions, and well-known companies at home and abroad, nearly 200000 developers to focus on the platform.

\

The recent hot

\

Use Python to crawl financial market data \

\

Build CNN model to crack website captcha \

\

Image recognition with Python (OCR) \

\

Analysis of employment status of Python development in Beijing \

\

Memories of youth in QQ space with Python \

\

Email: pythonpost@163.com

\

Please click below to read the original article. ** See all articles in the Python Chinese community at **** **